Products

What will AGI do for Bolandiol dipropionate?

This classification denotes an anabolic steroid with the molecular formula C24H36O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 595CNE7RHB, chemically known as 4-estrene-3-beta,17-beta-diol 3,17-dipropionate but more generally known as bolandiol dipropionate, which bears US NIH Compound Identifier 16141. Most nations, for tariff and trade purposes, schedule bolandiol dipropionate under HS 29061900 and SITC 51231. As of Q4 2014, BOLANDIOL DIPROPIONATE remains US FDA's Preferred Term for this commodity. Bolandiol dipropionate bears US NLM identifiers UMLS ID C3266850 and NCI Concept Code C87452. SMILES: CCC(=O)O[C@H]1CC[C@@H]2[C@H]3CC[C@]4([C@H]([C@@H]3CCC2=C1)CC[C@@H]4OC(=O)CC)C.