Products

What will AGI do for Bosentan hydrate?

This classification denotes an endothelin receptor antagonist with the molecular formula C27H29N5O6S.H2O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Q326023R30, chemically known as benzenesulfonamide, 4-(1,1-dimethylethyl)-n-(6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)(2,2'bipyrimidin)-4-yl)-, monohydrate, but more generally known as bosentan hydrate, which bears US NIH Compound Identifier 185462. European Medicines Agency schedules bosentan hydrate or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05877MIG. Most nations, for tariff purposes, schedule bosentan hydrate under HS 29350090. SMILES: CC(C)(C)C1CCC(CC1)S(=O)(=O)NC2C(C(NC(N2)C3NCCCN3)OCCO)OC4CCCCC4OC.O.