Products

What will AGI do for Brequinar?

This classification denotes a pyrimidine antagonist and dihydroorotate dehydrogenase inhibitor with the molecular formula C23H15F2NO2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, 5XL19F49H6 chemically known as 4-quinolinecarboxylic acid, 6-fluoro-2-(2'-fluoro(1,1'-biphenyl)-4-yl)-3-methyl- but generally known as brequinar, which bears US NIH Compound Identifier 57030. European Medicines Agency schedules Brequinar in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05885MIG. The term BREQUINAR is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 2, no. 3, 1988, list 28). Most nations schedule brequinar under HS 29334990 and SITC 51575. As of Q4 2014, BREQUINAR remains the US FDA Preferred Term for this commodity. Brequinar bears US NLM identifiers UMLS ID C0280509 and NCI Concept Code C1560. SMILES: CC1=C(N=C2C=CC(=CC2=C1C(=O)O)F)C3=CC=C(C=C3)C4=CC=CC=C4F.